Rebaudioside M
Rebaudioside M is a natural sweetener extracted from the stevia plant. It is commonly used as a substitute for sugar in various food and beverage products due to its high sweetness and low calorie content. Additionally, studies have shown that rebaudioside M may have potential applications in the treatment of diabetes and obesity due to its ability to regulate blood sugar levels and improve insulin sensitivity.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2705-003561 |
| Pricing | Inquire |
| Cas | 1220616-44-3 |
| Molecular Weight | 1291.29 |
| Molecular Formula | C56H90O33 |
| Canonical SMILES | CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)OC5C(C(C(C(O5)CO)O)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)(C)C(=O)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC1C(C(C(C(O1)CO)O)O)O |