Chlorphenamine EP Impurity C
An impurity of Chlorpheniramine, which inhibits the proliferation of MCF-7, MDA-MB 231, and Ehrlich cells in a dose-response manner, and significantly reduces the ornithine decarboxylase mRNA translation by 50%-70% at the 250 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-421154 |
| Pricing | Inquire |
| Cas | 20619-12-9 |
| Molecular Weight | 260.76 |
| Molecular Formula | C15H17ClN2 |
| Canonical SMILES | CNCCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2 |