6-Chloro-9-(β-D-2-deoxyribofuranosyl)purine
6-Chloro-9-(β-D-2-deoxyribofuranosyl)purine, a remarkable compound utilized in the biomedical realm, showcases substantial prowess as an antiviral agent. Its key purpose lies within combatting diverse viral infections, emblematically those instigated by the herpes family. By thwarting viral DNA synthesis, this compound proficiently hampers the replication of these intrusive pathogens. The astute amalgamation of an exceptional chemical framework and an intricately orchestrated mechanism efficaciously endows this entity with an unparalleled potential to counteract a wide array of viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4594-45-0 |
| Pricing | Inquire |
| Cas | 4594-45-0 |
| Molecular Weight | 270.68 |
| Molecular Formula | C10H11ClN4O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=CN=C3Cl)CO)O |