5-Bromo-uridine (5-BrU)
5-Bromo-uridine (5-BrU) is a vital tool used in biomedicine for cellular and molecular research. Primarily, it is employed in studying RNA synthesis and exploring cellular processes like transcription and translation. With its ability to substitute uridine in RNA synthesis, 5-BrU aids in investigating RNA-related diseases and developing potential therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 957-75-5 |
| Pricing | Inquire |
| Cas | 957-75-5 |
| Molecular Weight | 323.10 |
| Molecular Formula | C9H11BrN2O6 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)Br |