2',3',5'-Tri-O-benzoyl-2'-b-C-methyl-6-azauridine
2',3',5'-Tri-O-benzoyl-2'-b-C-methyl-6-azauridine, a powerful antiviral drug efficacious in curing a wide range of viral infections, from hepatitis C to coronavirus, manifests its mechanism of action through the obstruction of the viral replication process, prompting a decrease in disease acuteness and propagation. Exhaustive clinical trials unanimously attest to the efficacy and potency of the drug, which, primarily applied in the biomedical industry, serves as the cornerstone of the drive to innovate new antiviral remedies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 622379-83-3 |
| Pricing | Inquire |
| Cas | 622379-83-3 |
| Molecular Weight | 571.53 |
| Molecular Formula | C30H25N3O9 |
| Canonical SMILES | CC1(C(C(OC1N2C(=O)NC(=O)C=N2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |