2-Amino-2'-deoxy-N6,N6-dimethyl-2'-adenosine
2-Amino-2'-deoxy-N6,N6-dimethyl-2'-adenosine is an intriguing biomedical agent, conquering the realm of antiviral mastery and enveloping RNA pathogens within its strategic web. Through an artful act of termination, this compound disrupts viral replication. Such fortitude emanates from its prowess in inhibiting viral polymerase activity, thwarting the insidious dance of their replication and gallantly diminishing the burden of viral load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83061-20-5 |
| Pricing | Inquire |
| Cas | 83061-20-5 |
| Molecular Weight | 294.31 |
| Molecular Formula | C12H18N6O3 |
| Canonical SMILES | CN(C)C1=NC(=NC2=C1N=CN2C3CC(C(O3)CO)O)N |