6-O-tert-Butyldiphenylsilyl-3,4-O-isopropylidene-D-galactal
6-O-tert-Butyldiphenylsilyl-3,4-O-isopropylidene-D-galactal is an indispensible compound, showcasing remarkable significance in the research and development of medicinal substances and exploration of multifarious ailments. Its application as a foundational unit fosters the development of formidable anti-neoplastic drugs as well as serving as a precursor for constructing molecules oriented towards precise pathophysiologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 137792-66-6 |
| Pricing | Inquire |
| Cas | 137792-66-6 |
| Molecular Weight | 424.6 |
| Molecular Formula | C25H32O4Si |
| Canonical SMILES | CC1(OC2C=COC(C2O1)CO[Si](C3=CC=CC=C3)(C4=CC=CC=C4)C(C)(C)C)C |