DMT-2'O-Methyl-rC(tac) Phosphoramidite
DMT-2'O-Methyl-rC(tac) Phosphoramidite, a highly esteemed resource within the biomedical industry, plays a pivotal role in the synthesis of modified nucleic acids. Its profound utility lies in facilitating the integration of a 2'O-methyl cluster onto ribonucleosides, thereby empowering the creation of therapeutic oligonucleotides.
| Supplier | BOC Sciences |
|---|---|
| Product # | 179486-26-1 |
| Pricing | Inquire |
| Cas | 179486-26-1 |
| Molecular Weight | 950.07 |
| Molecular Formula | C52H64N5O10P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=CC(=NC2=O)NC(=O)COC3=CC=C(C=C3)C(C)(C)C)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |