GLUT inhibitor-1
GLUT inhibitor-1 is a potent and orally active inhibitor of glucose transporters, targeting both GLUT1 and GLUT3, with IC50s of 242 nM and 179 nM, respectively. GLUT inhibitor-1 has potential in the study of cancer and autoimmune diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2421141-40-2 |
| Pricing | Inquire |
| Cas | 2421141-40-2 |
| Molecular Weight | 549.67 |
| Molecular Formula | C32H35N7O2 |
| Canonical SMILES | CC1(CC1)NC(=O)COC2=CC=CC(=C2)C3=NC4=C(CN(CC4)C5CCC5)C(=N3)NC6=CC=C(C=C6)C7=CNN=C7 |