Betamethasone EP Impurity D
Betamethasone EP Impurity D is an intrinsic impurity present in the pharmaceutical drug Betamethasone. Betamethasone serves a multitude of purposes, particularly catering to the therapy of inflammatory cutaneous ailments encompassing eczema and psoriasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0435-467452 |
| Pricing | Inquire |
| Cas | 52619-05-3 |
| Molecular Weight | 464.54 |
| Molecular Formula | C25H33FO7 |
| Canonical SMILES | CCOC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)C)O |