Melanin Concentrating Hormone, salmon
Melanin Concentrating Hormone (MCH), salmon is a 19-amino acid neuropeptide, originally found in the pituitary gland of teleost fish, that regulates food intake, energy balance, sleep status and the cardiovascular system. MCH is a ligand for orphan G protein coupled receptor (SLC-1/GPR24) and MCHR2.
| Supplier | BOC Sciences |
|---|---|
| Product # | 87218-84-6 |
| Pricing | Inquire |
| Cas | 87218-84-6 |
| Molecular Weight | 2099.48 |
| Molecular Formula | C89H139N27O24S4 |
| Canonical SMILES | CC(C)C1C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CCSC)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCSC)NC(=O)C(C(C)O)NC(=O)C(CC(=O)O)N)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CCC(=O)O)C(=O)NC(C(C)C)C(=O)O)CCCNC(=N)N)CC5=CC=C(C=C5)O)C(C)C)CCCNC(=N)N |