3-Fluoro-N-acetyl-neuraminic acid
3-Fluoro-N-acetyl-neuraminic acid is a widely utilized compound, exhibiting inhibitory efficacy against various viral infections, notably influenza viruses. Distinguished for its potent antiviral attributes, it proficiently impedes viral replication. Notably, this acid selectively targets the neuraminidase enzyme within the viral entity, consequently impeding its liberation from the afflicted cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 921-40-4 |
| Pricing | Inquire |
| Cas | 921-40-4 |
| Molecular Weight | 327.26 |
| Molecular Formula | C11H18FNO9 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1C(C(CO)O)O)(C(=O)O)O)F)O |