N1-EthylpseudoUridine
N1-EthylpseudoUridine is an indispensable compound in the biomedical field, demonstrating profound applications encompass disease research, prevention and intervention. This exceptional substance exhibits unparalleled potential in studying viral onslaughts, malignant neoplasms and neurologic afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-339943 |
| Pricing | Inquire |
| Cas | 1613529-72-8 |
| Molecular Weight | 272.25 |
| Molecular Formula | C11H16N2O6 |
| Canonical SMILES | CCN1C=C(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |