Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester
Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester, a compound of immense significance in the biomedical industry, finds extensive utility in research endeavors. Its role as a synthetic precursor in targeting diseases, namely cancer, inflammation, and hepatic disorders, renders it indispensable. This remarkable compound showcases promising therapeutic traits, propelling advancements in comprehending molecular intricacies governing multiple pathological states.
| Supplier | BOC Sciences |
|---|---|
| Product # | 77392-66-6 |
| Pricing | Inquire |
| Cas | 77392-66-6 |
| Molecular Weight | 362.33 |
| Molecular Formula | C15H22O10 |
| Canonical SMILES | CCOC1C(C(C(C(O1)C(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C |