B I09
B I09 is a cell permeable IRE-1 RNase inhibitor (IC50 = 1.23 μM) that blocks IRE-1/XBP1 pathway. B I09 exhibits an inhibitory effect on growth of human chronic lymphocytic leukemia (CLL) cells in vitro and promotes CLL regression in a mouse model.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1607803-67-7 |
| Pricing | Inquire |
| Cas | 1607803-67-7 |
| Molecular Weight | 303.31 |
| Molecular Formula | C16H17NO5 |
| Canonical SMILES | C1COC(OC1)C2=C(C=CC3=C2OC(=O)C4=C3CCNC4)O |