BE-12406 B
BE-12406 B is an antitumor antibiotic produced by Streptomyces rutrersensis subsp. castelarensis. It has the activity of inhibiting murine P388 leukemia cells (IC50 is 7 µmol/L), and has the same activity against vincristine-doxorubicin resistant strains (P388/VCR) (IC50 is 7 µmol/L). It can inhibit the growth of S480 ascites carcinoma in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03226 |
| Pricing | Inquire |
| Cas | 132417-97-1 |
| Molecular Weight | 454.43 |
| Molecular Formula | C24H22O9 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=C3C(=C4C(=C2)C5=C(C=C(C=C5O)C)C(=O)O4)C=CC=C3O)O)O)O |