3-[(3-Acrylamidopropyl)dimethylammonio]propanoate
3-[(3-Acrylamidopropyl)dimethylammonio]propanoate, an extensively employed biomedical compound, serves as a monomer essential in the synthesis of affinity chromatography resins. Its exceptional attributes allow for effective purification and separation of various biomolecules, exemplified by proteins and peptides. This particular compound exhibits distinctive chemical characteristics, rendering it highly suitable for a broad range of biomedical research undertakings, encompassing drug discovery, molecular biology, and biochemistry studies.
Supplier | BOC Sciences |
---|---|
Product # | 79704-35-1 |
Pricing | Inquire |
Cas | 79704-35-1 |
Molecular Weight | 228.29 |
Molecular Formula | C11H20N2O3 |
Canonical SMILES | C[N+](C)(CCCNC(=O)C=C)CCC(=O)[O-] |