8-Nitroguanosine
A highly reactive redox-active nucleic acid derivative that is formed in cellular RNA as biomarker of exposure to reactive nitrogen species. Recent studies suggest that it might contribute to the pathogenesis of inflammation-associated carcinogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 337536-53-5 |
| Pricing | Inquire |
| Cas | 337536-53-5 |
| Molecular Weight | 328.24 |
| Molecular Formula | C10H12N6O7 |
| Canonical SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)N=C2[N+](=O)[O-])O)O)O |