1-(Phenylsulfonyl)indole-3-boronic acid pinacol ester, 97%
1-(Phenylsulfonyl)-3-indolylboronic acid pinacol ester can be used:• In one or two key synthetic steps for the preparation of a key intermediate of lycogarubin C.• To prepare 3-(4,5-dibromo-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-imidazol-2-yl)-1-(phenylsulfonyl)-1H-indole, a key intermediate for the synthesis of tubulin inhibitor VERU-111 analogs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870717-93-4 |
| Pricing | Inquire |
| Cas | 870717-93-4 |
| Molecular Weight | 383.27 |
| Molecular Formula | C20H22BNO4S |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=CC=CC=C23)S(=O)(=O)C4=CC=CC=C4 |