2-Bromo-2',3',5'-tri-O-acetylinosine
2-Bromo-2',3',5'-tri-O-acetylinosine is a biomedical product widely utilized in the research and development of antiviral drugs targeting herpes viruses. This compound exhibits antiviral activity against herpes simplex viruses (HSV-1 and HSV-2) by inhibiting viral replication. Its pharmacological properties make it a valuable tool for studying viral life cycles and developing potential antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 41623-91-0 |
| Pricing | Inquire |
| Cas | 41623-91-0 |
| Molecular Weight | 473.23 |
| Molecular Formula | C16H17BrN4O8 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2N=C(NC3=O)Br)OC(=O)C)OC(=O)C |