5'-Amino-5'-deoxy-2',3'-O-(1-methylethylidene)-adenosine
5'-Amino-5'-deoxy-2',3'-O-(1-methylethylidene)-adenosine, an exceptionally potent nucleoside analogue, exhibits remarkable antiviral characteristics. Its application in the biomedical sector revolves around combatting viral infections, primarily those necessitating adenosine for replication. An impressive attribute of this substance lies in its ability to impede viral replication by derailing the intricate viral RNA synthesis pathway, rendering it highly efficacious against an extensive spectrum of viral ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21950-36-7 |
| Pricing | Inquire |
| Cas | 21950-36-7 |
| Molecular Weight | 306.32 |
| Molecular Formula | C13H18N6O3 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC4=C(N=CN=C43)N)CN)C |