5'-O-Tritylinosine
KIN59 is a purine riboside derivative that suppresses thymidine phosphorylase (TPase). TPase is an enzyme catalyzing the reversible phosphorolysis of pyrimidine deoxynucleosides to 2-deoxy-d-ribose-1-phosphate and their respective pyrimidine bases. KIN59 noncompetitively inhibits TPase-induced angiogenesis in the chorioallantoic membrane assay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4152-77-6 |
| Pricing | Inquire |
| Cas | 4152-77-6 |
| Molecular Weight | 510.55 |
| Molecular Formula | C29H26N4O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC4C(C(C(O4)N5C=NC6=C5N=CNC6=O)O)O |