1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethylamine
1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethylamine (CAS# 1270452-52-2) is a versatile reactant used as a building block in organic synthesis. It is synthesized from 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone (B688930), which is a reactant used in the synthesis of Benzoxazinones and evaluated as a potent elongase 6 inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB006721 |
| Pricing | Inquire |
| Cas | 1270452-52-2 |
| Molecular Weight | 272.04 |
| Molecular Formula | C8H6BrF4N |
| Canonical SMILES | C1=CC(=C(C=C1Br)C(C(F)(F)F)N)F |