Pacidamycin D
It is produced by the strain of Streptomyces coeruleorubidus NRRL 18370. It's a Pacidamycin antibiotic. It has the activity against pseudomonas aeruginosa with MIC of 4-16 μg/mL. it has no effect on other gram-negative bacteria and gram-positive bacteria, and no effect on drug-resistant pseudomonas aeruginosa.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02337 |
| Pricing | Inquire |
| Cas | 287107-95-3 |
| Molecular Weight | 711.72 |
| Molecular Formula | C32H41N9O10 |
| Canonical SMILES | CC(C(C(=O)NC=C1CC(C(O1)N2C=CC(=O)NC2=O)O)NC(=O)C(C)NC(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)O)N(C)C(=O)C(C)N |