Guanoxyfen sulfate
Guanoxyfen sulfate is an inhibitor of vasoconstrictor responses to sympathetic nerve stimulation. It could potentiate the actions of adrenaline and noradrenaline. It also could increase the blood glucose concentration and decrease the appetite.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1021-11-0 |
| Pricing | Inquire |
| Cas | 1021-11-0 |
| Molecular Weight | 484.57 |
| Molecular Formula | C20H32N6O6S |
| Canonical SMILES | C1=CC=C(C=C1)OCCCN=C(N)N.C1=CC=C(C=C1)OCCCN=C(N)N.OS(=O)(=O)O |