Finasteride acetate
Finasteride acetate is a specific inhibitor of 5α-reductase. Finasteride can be used in the treatment of men with benign prostatic, and through the assessment of the long-term safety and efficacy of finasteride hyperplasia (BPH) it was well tolerated, wit
| Supplier | BOC Sciences |
|---|---|
| Product # | 222989-99-3 |
| Pricing | Inquire |
| Cas | 222989-99-3 |
| Molecular Weight | 432.60 |
| Molecular Formula | C25H40N2O4 |
| Canonical SMILES | CC(=O)O.CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C |