Clevudine
Clevudine is an inhibitor of hepatitis B virus (HBV). It is metabolized in cells by the cellular thymidine kinase as well as deoxycytidine kinase to its monophosphate, and subsequently to the di- and triphosphate, which are biologically active.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-085286 |
| Pricing | Inquire |
| Cas | 163252-36-6 |
| Molecular Weight | 260.22 |
| Molecular Formula | C10H13FN2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)F |