Penicillin
It is produced by the strain of Cephalosporium aceemonium, C. salmosynnematum, Emericellopsis salmosynnemata. It has weak anti-gram-positive bacteria (activity against Staphylococcus aureus is only 1% of penicillin G) and anti-gram-negative bacteria activity, and can be broken down by penicillinase and cross-resistant to penicillin G.
| Supplier | BOC Sciences |
|---|---|
| Product # | 525-94-0 |
| Pricing | Inquire |
| Cas | 525-94-0 |
| Molecular Weight | 359.40 |
| Molecular Formula | C14H21N3O6S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CCCC(C(=O)O)N)C(=O)O)C |