Cytidine-5'-triphosphoric acid sodium salt
Cytidine-5'-triphosphoric acid sodium salt, a pivotal compound widely employed in the biomedical sphere, emerges as a fundamental building block for RNA and DNA synthesis. With a vested interest in numerous cellular processes, this compound serves as a precursor for CTP synthesis, an indispensable nucleotide. Its utilization extends to address ailments rooted in nucleotide metabolism and aberrations linked to DNA/RNA synthesis, thereby demonstrating its therapeutic potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18423-42-2 |
| Pricing | Inquire |
| Cas | 18423-42-2 |
| Molecular Weight | 483.16 (free acid) |
| Molecular Formula | C9H16N3O14P3 (free acid) |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)[O-])O)O.[Na+] |