2'-Deoxy-N1-methylguanosine
2'-Deoxy-N1-methylguanosine, a nucleoside analog, is an intriguing compound that piques the interest of researchers seeking a deeper understanding of RNA's idiosyncrasies. As an inhibitor, it displays remarkable efficacy in preventing the replication of flaviviruses. Conversely, its utilization as a substrate during the synthesis of modified RNAs signals its versatility, as it endows these modified variants with resistance against enzymatic degradation. What makes 2'-Deoxy-N1-methylguanosine truly fascinating is its multifaceted nature, which warrants further exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5132-79-6 |
| Pricing | Inquire |
| Cas | 5132-79-6 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CN1C(=O)C2=C(N=C1N)N(C=N2)C3CC(C(O3)CO)O |