Cellobionic acid ammonium salt
Cellobionic acid ammonium salt is a potent biomedical solution used in the research of various metabolic disorders. With its unique chemical properties, it assists in the compoundion of specific enzymes is studying enzymatic deficiencies caused by genetic disorders. T
| Supplier | BOC Sciences |
|---|---|
| Product # | 534-41-8 |
| Pricing | Inquire |
| Cas | 534-41-8 |
| Molecular Weight | 375.33 |
| Molecular Formula | C12H25NO12 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC(C(CO)O)C(C(C(=O)O)O)O)O)O)O)O |