(2R,3R,4R,5R)-5-(2-Amino-6-chloro-9H-purin-9-yl)-2-[(4-chlorobenzoyloxy)methyl]-4-fluoro-4-methyloxolan-3-yl 4-chlorobenzoate
(2R,3R,4R,5R)-5-(2-Amino-6-chloro-9H-purin-9-yl)-2-[(4-chlorobenzoyloxy)methyl]-4-fluoro-4-methyloxolan-3-yl 4-chlorobenzoate is an exemplarily remarkable medication for treating chronic lymphocytic leukemia and small lymphocytic leukemia. This class of drugs known as nucleoside analogues remarkably functions by interfering with cancer cells' DNA synthesis and leads to their ultimate death.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1294481-82-5 |
| Pricing | Inquire |
| Cas | 1294481-82-5 |
| Molecular Weight | 594.81 |
| Molecular Formula | C25H19Cl3FN5O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=C(N=C3Cl)N)COC(=O)C4=CC=C(C=C4)Cl)OC(=O)C5=CC=C(C=C5)Cl)F |