4,5-Dihydro-5-methyl-3,4-diphenyl-5-isoxazolol-[13C2,15N]
4,5-Dihydro-5-methyl-3,4-diphenyl-5-isoxazolol-[13C2,15N] is a labelled intermediate for the preparation of Valdecoxib. Valdecoxib is a non-steroidal anti-inflammatory drug (NSAID) used for the treatment of osteoarthritis, rheumatoid arthritis, etc. Valdecoxib exhibits a selectively inhibitory effect against cyclooxygenase-2.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007747 |
| Pricing | Inquire |
| Cas | 1189468-68-5 |
| Molecular Weight | 256.27 |
| Molecular Formula | C14[13C]2H15[15N]O2 |
| Canonical SMILES | CC1(C(C(=NO1)C2=CC=CC=C2)C3=CC=CC=C3)O |