ML-323
ML323 is a reversible and potent USP1-UAF1 inhibitor with IC50 vallue of 76 nM in a Ub-Rho assay and 174 nM and 820 nM in orthogonal gel-based assays using K63-linked diubiquitin (di-Ub) and monoubiquitinated PCNA (Ub-PCNA) as substrates, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1572414-83-5 |
| Pricing | Inquire |
| Cas | 1572414-83-5 |
| Molecular Weight | 384.487 |
| Molecular Formula | C23H24N6 |
| Canonical SMILES | CC1=CN=C(N=C1NCC2=CC=C(C=C2)N3C=CN=N3)C4=CC=CC=C4C(C)C |