5'(R)-C-Methyl-5-methyluridine
5'(R)-C-Methyl-5-methyluridine - an essential constituent in the biomedicine sector, precisely utilized for the advancement of antiviral medications. Demonstrating remarkable effectiveness against RNA viruses, it presents substantial value in combating viral infections. Its exceptional molecular configuration holds immense therapeutic promise, signifying a gateway for extensive examination and propitious advancements in antiviral therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129745-35-3 |
| Pricing | Inquire |
| Cas | 129745-35-3 |
| Molecular Weight | 272.25 |
| Molecular Formula | C11H16N2O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)C(C)O)O)O |