2-CHLOROBENZYLZINC CHLORIDE
2-Chlorobenzylzinc Chloride, an organozinc exemplar, plays a paramount role as a reagent. Its contribution chiefly lies in the pharmaceuticals synthesis process- leveraging its distinctive properties to engineer chemical reactions manifesting in a panoply of disease-combatting drugs.
Supplier | BOC Sciences |
---|---|
Product # | 312624-11-6 |
Pricing | Inquire |
Cas | 312624-11-6 |
Molecular Weight | 226.42 |
Molecular Formula | C7H6Cl2Zn |
Canonical SMILES | [CH2-]C1=CC=CC=C1Cl.Cl[Zn+] |