5-(difluoromethoxy)-1H-benzo[d]imidazol-2-ol
An impurity of Pantoprazole which is a proton pump inhibitor used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1806469-15-7 |
| Pricing | Inquire |
| Cas | 1806469-15-7 |
| Molecular Weight | 200.14 |
| Molecular Formula | C8H6F2N2O2 |
| Canonical SMILES | C1=CC2=C(C=C1OC(F)F)NC(=O)N2 |