Prednisone 21-acetate
A derivative of Prednisone.Prednisone is a synthetic corticosteroid drug. It can be used for the treatment of certain inflammatory diseases, some autoimmune diseases, and (at higher doses) some types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125-10-0 |
| Pricing | Inquire |
| Cas | 125-10-0 |
| Molecular Weight | 400.46 |
| Molecular Formula | C23H28O6 |
| Canonical SMILES | CC(=O)OCC(=O)C1(CCC2C1(CC(=O)C3C2CCC4=CC(=O)C=CC34C)C)O |