Hexyl 2-acetamido-2-deoxy-b-D-glucopyranoside
Hexyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a vital component in the biomedical industry. This product is used as a sugar mimic to study the cellular uptake and metabolism of glucose and to understand its role in various diseases, including diabetes, cancer, and metabolic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 190912-49-3 |
| Pricing | Inquire |
| Cas | 190912-49-3 |
| Molecular Weight | 305.37 |
| Molecular Formula | C14H27NO6 |
| Canonical SMILES | CCCCCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C |