(1S)-1,4-Anhydro-1-C-(2,4-difluorophenyl)-D-ribitol
(1S)-1,4-Anhydro-1-C-(2,4-difluorophenyl)-D-ribitol is a chemical compound used in the biomedical industry as an antiviral drug to treat influenza A and B viruses. It works by inhibiting viral neuraminidase, preventing the virus from spreading and multiplying in the body.
| Supplier | BOC Sciences |
|---|---|
| Product # | 263701-23-1 |
| Pricing | Inquire |
| Cas | 263701-23-1 |
| Molecular Weight | 246.21 |
| Molecular Formula | C11H12F2O4 |
| Canonical SMILES | C1=CC(=C(C=C1F)F)C2C(C(C(O2)CO)O)O |