Pyrronamycin B
Pyrronamycin B is produced by the strain of Streptomyces sp. KY11768. It has antibacterial activity against gram-positive and negative bacteria such as Staphylococcus aureus, enterococcus, Escherichia coli, Klebsiella pneumoniae, Proteus, Shigella and Salmonella. It also has anti-tumor activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02156 |
| Pricing | Inquire |
| Molecular Weight | 555.55 |
| Molecular Formula | C23H29N11O6 |
| Canonical SMILES | C1=C(NC=C1NC(=O)CN=C(N)NO)C(=O)NC2=CNC(=C2)C(=O)NC(CC(=O)NC(CC=CCN)C=O)C#N |