Methyl 2,3-O-isopropylidene-5-O-(4-toluenesulfonyl)-b-D-ribofuranoside
Methyl 2,3-O-isopropylidene-5-O-(4-toluenesulfonyl)-b-D-ribofuranoside is a chemical compound extensively employed in the biomedical sector, serving as a foundational reactant in a myriad of drug synthesis endeavors. It is used in the research of synthesis of nucleoside analogs or antiviral compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13007-50-6 |
| Pricing | Inquire |
| Cas | 13007-50-6 |
| Molecular Weight | 358.4 |
| Molecular Formula | C16H22O7S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2C3C(C(O2)OC)OC(O3)(C)C |