trans-Resveratrol 4-O-b-D-glucopyranoside
trans-Resveratrol 4-O-b-D-glucopyranoside is a widely occurring bioactive constituent in botanical sources, renowned for its formidable antioxidant capabilities. This compound finds paramount applications in studying a myriad of afflictions encompassing neoplastic malignancies, cardiovascular maladies and neurodegenerative pathologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38963-95-0 |
| Pricing | Inquire |
| Cas | 38963-95-0 |
| Molecular Weight | 390.38 |
| Molecular Formula | C20H22O8 |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)OC3C(C(C(C(O3)CO)O)O)O |