Mericitabine
R-7128 is a selective nucleoside analog inhibitor of the hepatitis C virus (HCV) NS5B RNA-dependent RNA polymerase, with activity across all HCV genotypes. It is a nucleoside polymerase inhibitor (NPI) and is able to inhibit the RNA synthesis of HCV in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | 940908-79-2 |
| Pricing | Inquire |
| Cas | 940908-79-2 |
| Molecular Weight | 399.41 |
| Molecular Formula | C18H26FN3O6 |
| Canonical SMILES | CC(C)C(=O)OCC1C(C(C(O1)N2C=CC(=NC2=O)N)(C)F)OC(=O)C(C)C |