Monorden D
Monorden D is a metabolite of Humicola sp. FO-2942. It has the effect of arresting the cell cycle of Jurket cells in G1 and G2/M phases. It has anti-Aspergillus niger activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02563 |
| Pricing | Inquire |
| Cas | 544712-82-5 |
| Molecular Weight | 350.79 |
| Molecular Formula | C18H19ClO5 |
| Canonical SMILES | CC1CC=CCCC=CC(=O)CC2=C(C(=CC(=C2Cl)O)O)C(=O)O1 |