4-Nitrophenyl-methoxycarbonylamino Amoxicillin
4-Nitrophenyl-methoxycarbonylamino Amoxicillin is an intermediate used in the synthesis of Amoxicillin, which is an antibiotic used to treat a number of bacterial infections including middle ear infections, strep throat, pneumonia, skin infections, and urinary tract infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109880-73-1 |
| Pricing | Inquire |
| Cas | 109880-73-1 |
| Molecular Weight | 544.53 |
| Molecular Formula | C24H24N4O9S |
| Canonical SMILES | O=C(OCC1=CC=C(C=C1)N(=O)=O)NC(C(=O)NC2C(=O)N3C2SC(C)(C)C3C(=O)O)C4=CC=C(O)C=C4 |