Propargyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside
Propargyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside is a crucial compound used as a substrate for enzymes involved in carbohydrate metabolism and glycosylation processes. It finds application in the synthesis of complex carbohydrates and investigations regarding the role of glycans in disease progression, such as cancer and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 211688-84-5 |
| Pricing | Inquire |
| Cas | 211688-84-5 |
| Molecular Weight | 386.35 |
| Molecular Formula | C17H22O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OCC#C)OC(=O)C)OC(=O)C)OC(=O)C |