2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride
2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride, a highly potent reagent, finds valuable application in the realm of biomedicine. Its utilization lies in the synthesis of drugs and probes based on carbohydrates, thereby rendering it indispensable in the pursuit of scientific advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2823-46-3 |
| Pricing | Inquire |
| Cas | 2823-46-3 |
| Molecular Weight | 350.29 |
| Molecular Formula | C14H19FO9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)F)OC(=O)C)OC(=O)C)OC(=O)C |