2- Amino- 7- chloro- 1- ethyl- N- methyl- 4- oxo- 1, 4- dihydro- 1, 8- naphthyridine- 3- carboxamide
2-Amino-7-chloro-1-ethyl-1,4-dihydro-N-methyl-4-oxo-1,8-naphthyridine-3-carboxamide is an intermediate in the synthesis of SAR131675 (S139510), is a potent and selective VEGFR-3 inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB061338 |
| Pricing | Inquire |
| Cas | 1092523-24-4 |
| Molecular Weight | 280.71 |
| Molecular Formula | C12H13ClN4O2 |
| Canonical SMILES | CCN1C(=C(C(=O)C2=C1N=C(C=C2)Cl)C(=O)NC)N |