N,N'-Disuccinimidyl carbonate
N,N'-Disuccinimidyl Carbonate is a commonly used reagent for the preparation of N-succinimidyl esters of N-protected amino acids, activated carbonate, synthesis of urea, carbamates and coupling of ligands to proteins. The coupling reagent property of N,N'-Disuucinimidyl Carbonate speeds up coupling process, while reduces the loss of chiral integrity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-002408 |
| Pricing | Inquire |
| Cas | 74124-79-1 |
| Molecular Weight | 256.17 |
| Molecular Formula | C9H8N2O7 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O |